Common Name: Eupalinolide D
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H32O10/c1-14(9-10-32-17(4)27)25(30)35-23-12-20(13-33-18(5)28)7-8-21(34-19(6)29)15(2)11-22-24(23)16(3)26(31)36-22/h7,9,11,21-24H,3,8,10,12-13H2,1-2,4-6H3/b14-9+,15-11-,20-7-/t21-,22+,23+,24-/m0/s1
InChIKey: InChIKey=VQZFCKAEAQYAIF-UPYGITSNSA-N
Formula: C26H32O10
Molecular Weight: 504.527287
Exact Mass: 504.199547
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Wang, Y., Zou, Z.M. Chin J Nat Med (2008) 6, 339-45
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Germacranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 129.7 |
| 2 (CH2) | 29.4 |
| 3 (CH) | 71.4 |
| 4 (C) | 136.3 |
| 5 (CH) | 126.4 |
| 6 (CH) | 78.2 |
| 7 (CH) | 48.5 |
| 8 (CH) | 74 |
| 9 (CH2) | 37.5 |
| 10 (C) | 134.5 |
| 11 (C) | 137 |
| 12 (C) | 169.5 |
| 13 (CH2) | 124.7 |
| 14 (CH2) | 62.8 |
| 15 (CH3) | 23 |
| 3a (C) | 170.3 |
| 3b (CH3) | 20.5 |
| 8a (C) | 165.6 |
| 8b (C) | 129.7 |
| 8c (CH) | 139.3 |
| 8d (CH2) | 60.8 |
| 8e (CH3) | 12.6 |
| 8f (C) | 169.3 |
| 8g (CH3) | 20.9 |
| 14a (C) | 170.4 |
| 14b (CH3) | 20.6 |