Common Name: Minimaoside B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H34O9/c1-8-4-12-10(9(2)19(27)28-12)6-21(3)14(5-11(23)15(8)21)30-20-18(26)17(25)16(24)13(7-22)29-20/h8-18,20,22-26H,4-7H2,1-3H3/t8-,9+,10-,11+,12-,13-,14-,15-,16-,17+,18-,20+,21-/m1/s1
InChIKey: InChIKey=LEIBTXFEVFPPPD-OYKWTLHGSA-N
Formula: C21H34O9
Molecular Weight: 430.490084
Exact Mass: 430.220283
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Ding, L.F., Liu, Y., Liang, H.X., Liu, D.P., Zhou, G.B., Cheng, Y.X. J Asian Nat Prod Res (2009) 11, 732-6
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Guaianes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 55 |
| 2 (CH) | 77.3 |
| 3 (CH2) | 41.8 |
| 4 (CH) | 88.3 |
| 5 (C) | 48.5 |
| 6 (CH2) | 39.5 |
| 7 (CH) | 45.1 |
| 8 (CH) | 79.8 |
| 9 (CH2) | 36.1 |
| 10 (CH) | 30.7 |
| 11 (CH) | 44 |
| 12 (C) | 182.7 |
| 13 (CH3) | 17.4 |
| 14 (CH3) | 21.1 |
| 15 (CH3) | 22.3 |
| 1' (CH) | 101.9 |
| 2' (CH) | 75.4 |
| 3' (CH) | 77.9 |
| 4' (CH) | 72.1 |
| 5' (CH) | 77.8 |
| 6' (CH2) | 63.1 |