Common Name: (+)-Diasyringaresinol
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21-,22-/m0/s1
InChIKey: InChIKey=KOWMJRJXZMEZLD-WJWAULOUSA-N
Formula: C22H26O8
Molecular Weight: 418.437889
Exact Mass: 418.162768
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - David, J.M., Chavez, J.P., Chai, H.B., Pezzuto, J.M., Cordell, G.A. J Nat Prod (1998) 61, 287-9
Species:
Notes: Family : Lignans, Type : Lignans, Group : Bisepoxylignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 130.03 |
| 2 (CH) | 103.05 |
| 3 (C) | 147.03 |
| 4 (C) | 133.87 |
| 5 (C) | 147.03 |
| 6 (CH) | 103.05 |
| 7 (CH) | 84.17 |
| 8 (CH) | 49.53 |
| 9 (CH2) | 68.78 |
| 1' (C) | 130.03 |
| 2' (CH) | 103.05 |
| 3' (C) | 147.03 |
| 4' (C) | 133.87 |
| 5' (C) | 147.03 |
| 6' (CH) | 103.05 |
| 7' (CH) | 84.17 |
| 8' (CH) | 49.53 |
| 9' (CH2) | 68.78 |
| 3a (CH3) | 56.33 |
| 5a (CH3) | 56.33 |
| 3'a (CH3) | 56.33 |
| 6'a (CH3) | 56.33 |