Common Name: (E)-3-[(1-Isopropyl-4-methyl-3-cyclohexenyl)oxy]-5-methoxystilbene
Synonyms: (E)-3-[(1-Isopropyl-4-methyl-3-cyclohexenyl)oxy]-5-methoxystilbene
CAS Registry Number:
InChI: InChI=1S/C25H30O2/c1-19(2)25(14-12-20(3)13-15-25)27-24-17-22(16-23(18-24)26-4)11-10-21-8-6-5-7-9-21/h5-12,16-19H,13-15H2,1-4H3/b11-10+
InChIKey: InChIKey=FHNNVZMWQSSCHB-ZHACJKMWSA-N
Formula: C25H30O2
Molecular Weight: 362.50543
Exact Mass: 362.22458
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Ngo, K.S., Brown, G.D. Phytochemistry (1998) 47, 1117-23
Species:
Notes: Family : Aromatics, Type : Stilbenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 157.2 |
| 2 (CH) | 108.6 |
| 3 (C) | 160.3 |
| 4 (CH) | 105.9 |
| 5 (C) | 138.6 |
| 6 (CH) | 114 |
| 7 (CH) | 128.8 |
| 8 (CH) | 128.9 |
| 9 (C) | 137.2 |
| 10 (CH) | 126.6 |
| 11 (CH) | 128.7 |
| 12 (CH) | 127.7 |
| 13 (CH) | 128.7 |
| 14 (CH) | 126.6 |
| 1' (C) | 134 |
| 2' (CH) | 118.3 |
| 3' (CH2) | 31.1 |
| 4' (C) | 83.6 |
| 5' (CH2) | 28.5 |
| 6' (CH2) | 27.9 |
| 7' (CH) | 33.2 |
| 8' (CH3) | 17.5 |
| 9' (CH3) | 17.6 |
| 10' (CH3) | 23.2 |
| 3a (CH3) | 55.3 |