Common Name: 2b,9a,14a-Triacetoxy-3a-hydroxy-1(15),8(19)-trinervitadiene
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H38O7/c1-13-8-9-20(31-16(4)27)14(2)19-10-11-26(7)23(19)15(3)22(21(12-13)32-17(5)28)24(25(26)30)33-18(6)29/h13,19-21,23-25,30H,2,8-12H2,1,3-7H3/t13-,19-,20+,21-,23+,24+,25-,26-/m0/s1
InChIKey: InChIKey=BEUNFZMOHHYNPI-QHCGCOPUSA-N
Formula: C26H38O7
Molecular Weight: 462.576716
Exact Mass: 462.261754
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Laurent, P., Daloze, D., Pasteels, J.M., Braekman, J.C. J Nat Prod (2005) 68, 532-6
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Trinervitanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 130 |
| 2 (CH) | 77.4 |
| 3 (CH) | 71.2 |
| 4 (C) | 47.4 |
| 5 (CH2) | 36.1 |
| 6 (CH2) | 30.7 |
| 7 (CH) | 52.1 |
| 8 (C) | 151.7 |
| 9 (CH) | 68.8 |
| 10 (CH2) | 32.6 |
| 11 (CH2) | 33 |
| 12 (CH) | 25 |
| 13 (CH2) | 37.6 |
| 14 (CH) | 70.7 |
| 15 (C) | 136.6 |
| 16 (CH) | 57.3 |
| 17 (CH3) | 22.4 |
| 18 (CH3) | 20.3 |
| 19 (CH2) | 118 |
| 20 (CH3) | 23.7 |
| 2a (C) | 172.7 |
| 2b (CH3) | 21.6 |
| 9a (C) | 170.7 |
| 9b (CH3) | 21.4 |
| 14a (C) | 170.3 |
| 14b (CH3) | 20.9 |