Common Name: 3R,10R-Diacetoxy-7,16-secotrinervita-7,11,15(17)-triene
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H36O4/c1-16-8-7-11-24(6)15-18(3)21(14-23(24)28-20(5)26)10-9-17(2)13-22(12-16)27-19(4)25/h8,13,21-23H,3,7,9-12,14-15H2,1-2,4-6H3/b16-8+,17-13+/t21-,22+,23+,24+/m1/s1
InChIKey: InChIKey=AFYWMGYXNAOFCH-QTJIDTAASA-N
Formula: C24H36O4
Molecular Weight: 388.541148
Exact Mass: 388.26136
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Chiaramello, A.I., Ardanaz, C.E., Garcia, E.E., Rossomando, P.C. Phytochemistry (2003) 63, 883-6
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Trinervitanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 37.5 |
| 2 (CH2) | 36.4 |
| 3 (CH) | 74.9 |
| 4 (C) | 38.8 |
| 5 (CH2) | 36.9 |
| 6 (CH2) | 24.7 |
| 7 (CH) | 129.4 |
| 8 (C) | 129.5 |
| 9 (CH2) | 45.5 |
| 10 (CH) | 69.3 |
| 11 (CH) | 125.8 |
| 12 (C) | 142 |
| 13 (CH2) | 37 |
| 14 (CH2) | 25.7 |
| 15 (C) | 147.7 |
| 16 (CH2) | 47.4 |
| 17 (CH2) | 103.8 |
| 18 (CH3) | 22.3 |
| 19 (CH3) | 15 |
| 20 (CH3) | 15.9 |
| 3a (C) | 170.2 |
| 3b (CH3) | 21.3 |
| 10a (C) | 170.6 |
| 10b (CH3) | 21.4 |