Common Name: Angelic acid [(3S)-2,7-dioxo-3,5abeta,9-trimethyl-6alpha-hydroxy-2,3,3abeta,4,5,5a,6,7,9aalpha,9bbeta-decahydronaphtho[1,2-b]furan]-3beta-yl ester
Synonyms: Angelic acid [(3S)-2,7-dioxo-3,5abeta,9-trimethyl-6alpha-hydroxy-2,3,3abeta,4,5,5a,6,7,9aalpha,9bbeta-decahydronaphtho[1,2-b]furan]-3beta-yl ester
CAS Registry Number:
InChI: InChI=1S/C20H26O6/c1-6-10(2)17(23)26-20(5)12-7-8-19(4)14(15(12)25-18(20)24)11(3)9-13(21)16(19)22/h6,9,12,14-16,22H,7-8H2,1-5H3/b10-6-/t12-,14+,15-,16-,19+,20+/m1/s1
InChIKey: InChIKey=ANEOWDWLJGVECN-DMKCIIKBSA-N
Formula: C20H26O6
Molecular Weight: 362.417607
Exact Mass: 362.172939
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Massanet, G.M., Guerra, F.M., Jorge, Z.D., Astorga, C. Phytochemistry (1997) 45, 1645-51
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Eudesmanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 78.1 |
| 2 (C) | 196.8 |
| 3 (CH) | 125.2 |
| 4 (C) | 162 |
| 5 (CH) | 48.8 |
| 6 (CH) | 76.6 |
| 7 (CH) | 40.3 |
| 8 (CH2) | 20.5 |
| 9 (CH2) | 30 |
| 10 (C) | 39.7 |
| 11 (C) | 79.6 |
| 12 (C) | 174.1 |
| 13 (CH3) | 20.3 |
| 14 (CH3) | 18.2 |
| 15 (CH3) | 23.7 |
| 1' (C) | 166.5 |
| 2' (C) | 126.9 |
| 3' (CH) | 140.5 |
| 4' (CH3) | 15.9 |
| 5' (CH3) | 18.5 |