Common Name: Angelic acid [(3S,3abeta,9abeta,9bbeta)-2-oxo-3,5aalpha-dimethyl-6alpha-hydroxy-9-methylenedodecahydronaphtho[1,2-b]furan]-3beta-yl ester
Synonyms: Angelic acid [(3S,3abeta,9abeta,9bbeta)-2-oxo-3,5aalpha-dimethyl-6alpha-hydroxy-9-methylenedodecahydronaphtho[1,2-b]furan]-3beta-yl ester
CAS Registry Number:
InChI: InChI=1S/C20H28O5/c1-6-11(2)17(22)25-20(5)13-9-10-19(4)14(21)8-7-12(3)15(19)16(13)24-18(20)23/h6,13-16,21H,3,7-10H2,1-2,4-5H3/b11-6-/t13-,14-,15-,16-,19+,20+/m1/s1
InChIKey: InChIKey=HMGKKEXJEBSEFK-LOPKJHGTSA-N
Formula: C20H28O5
Molecular Weight: 348.434084
Exact Mass: 348.193674
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Massanet, G.M., Guerra, F.M., Jorge, Z.D., Astorga, C. Phytochemistry (1997) 45, 1645-51
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Eudesmanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 79.1 |
| 2 (CH2) | 31.3 |
| 3 (CH2) | 34.2 |
| 4 (C) | 143.6 |
| 5 (CH) | 48.9 |
| 6 (CH) | 77.2 |
| 7 (CH) | 49 |
| 8 (CH2) | 20.5 |
| 9 (CH2) | 34.6 |
| 10 (C) | 43.7 |
| 11 (C) | 82.7 |
| 12 (C) | 173.8 |
| 13 (CH3) | 20.4 |
| 14 (CH3) | 11.7 |
| 15 (CH2) | 110.9 |
| 1' (C) | 166.4 |
| 2' (C) | 127.6 |
| 3' (CH) | 139.7 |
| 4' (CH3) | 15.3 |
| 5' (CH3) | 18.6 |