Common Name: Epiyangambin
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H30O8/c1-25-17-7-13(8-18(26-2)23(17)29-5)21-15-11-32-22(16(15)12-31-21)14-9-19(27-3)24(30-6)20(10-14)28-4/h7-10,15-16,21-22H,11-12H2,1-6H3/t15-,16-,21-,22+/m0/s1
InChIKey: InChIKey=HRLFUIXSXUASEX-WWLNLUSPSA-N
Formula: C24H30O8
Molecular Weight: 446.491124
Exact Mass: 446.194068
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Ahmed, A.A., Mahmoud, A.A., Ali, E.T., Tzakou, O., Couladis, M., Mabry, T.J., Gati, T., Toth, G. Phytochemistry (2002) 59, 851-6
Species:
Notes: Family : Lignans, Type : Lignans, Group : Bisepoxylignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 136.8 |
| 2 (CH) | 103 |
| 3 (C) | 153.4 |
| 4 (C) | 137.6 |
| 5 (C) | 153.4 |
| 6 (CH) | 103 |
| 7 (CH) | 87.8 |
| 8 (CH) | 54.5 |
| 9 (CH2) | 71.1 |
| 1' (C) | 134 |
| 2' (CH) | 102.6 |
| 3' (C) | 153.2 |
| 4' (C) | 137 |
| 5' (C) | 153.2 |
| 6' (CH) | 102.6 |
| 7' (CH) | 82.2 |
| 8' (CH) | 50 |
| 9' (CH2) | 69.8 |
| 3a (CH3) | 56.2 |
| 4a (CH3) | 60.8 |
| 5a (CH3) | 56.2 |
| 3'a (CH3) | 56.2 |
| 4'a (CH3) | 60.8 |
| 5'a (CH3) | 56.2 |