Common Name: Dicinnamide
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H24N2O2/c25-21(15-13-19-9-3-1-4-10-19)23-17-7-8-18-24-22(26)16-14-20-11-5-2-6-12-20/h1-6,9-16H,7-8,17-18H2,(H,23,25)(H,24,26)/b15-13+,16-14+
InChIKey: InChIKey=NXPDEWPVRYWKQX-WXUKJITCSA-N
Formula: C22H24N2O2
Molecular Weight: 348.439064
Exact Mass: 348.183778
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Clericuzio, M., Piovano, M., Chamy, M.C., Garbarino, J.A., Milanesio, M., Viterbo, D., Vidari, G., Finzid, P.V. Croatica Chemica Acta (2004) 77, 605-11
Species:
Notes: Family : Alkaloids, Type : Phenyl-alkanoids, Group : Phenylpropanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 38.3 |
| 2 (CH2) | 26.6 |
| 3 (CH2) | 26.6 |
| 4 (CH2) | 38.3 |
| 1' (CH) | 122.4 |
| 2' (CH) | 138.3 |
| 3' (C) | 134.9 |
| 4' (CH) | 128.8 |
| 5' (CH) | 127.3 |
| 6' (CH) | 129.2 |
| 7' (CH) | 127.3 |
| 8' (CH) | 128.8 |
| 9' (C) | 164.8 |
| 1'' (CH) | 122.4 |
| 2'' (CH) | 138.3 |
| 3'' (C) | 134.9 |
| 4'' (CH) | 128.8 |
| 5'' (CH) | 127.3 |
| 6'' (CH) | 129.2 |
| 7'' (CH) | 127.3 |
| 8'' (CH) | 128.8 |
| 9'' (C) | 164.8 |