Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C30H50O/c1-25(2)13-8-14-26(3)15-9-16-27(4)17-10-18-28(5)19-11-20-29(6)21-12-22-30(7)23-24-31/h13,15,17,19,21,23,31H,8-12,14,16,18,20,22,24H2,1-7H3/b26-15+,27-17+,28-19-,29-21-,30-23-
InChIKey: InChIKey=RXILURRBPAWICG-SLKMIFNPSA-N
Formula: C30H50O1
Molecular Weight: 426.71852
Exact Mass: 426.386166
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Singh, B., Agrawal, P.K., Thakur, R.S. Phytochemistry (1989) 28, 1980-1
Species:
Notes: Family : Terpenoids, Type : Triterpenoids, Group : Squalenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 58.44 |
| 2 (CH) | 124.76 |
| 3 (C) | 138.59 |
| 4 (CH2) | 31.67 |
| 5 (CH2) | 26.1 |
| 6 (CH) | 124.65 |
| 7 (C) | 134.85 |
| 8 (CH2) | 31.67 |
| 9 (CH2) | 26.1 |
| 10 (CH) | 124.65 |
| 11 (C) | 134.85 |
| 12 (CH2) | 31.67 |
| 13 (CH2) | 26.1 |
| 14 (CH) | 124.33 |
| 15 (C) | 134.64 |
| 16 (CH2) | 39.44 |
| 17 (CH2) | 26.36 |
| 18 (CH) | 124.21 |
| 19 (C) | 134.39 |
| 20 (CH2) | 39.44 |
| 21 (CH2) | 26.49 |
| 22 (CH) | 124.19 |
| 23 (C) | 134.33 |
| 24 (CH3) | 25.52 |
| 25 (CH3) | 17.3 |
| 26 (CH3) | 15.56 |
| 27 (CH3) | 15.56 |
| 28 (CH3) | 22.89 |
| 29 (CH3) | 22.89 |
| 30 (CH3) | 22.89 |