Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C32H52O2/c1-26(2)14-9-15-27(3)16-10-17-28(4)18-11-19-29(5)20-12-21-30(6)22-13-23-31(7)24-25-34-32(8)33/h14,16,18,20,22,24H,9-13,15,17,19,21,23,25H2,1-8H3/b27-16+,28-18+,29-20-,30-22-,31-24-
InChIKey: InChIKey=IEQPJCFHRVVYJC-HQUKMZQHSA-N
Formula: C32H52O2
Molecular Weight: 468.755278
Exact Mass: 468.396731
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Singh, B., Agrawal, P.K., Thakur, R.S. Phytochemistry (1989) 28, 1980-1
Species:
Notes: Family : Terpenoids, Type : Triterpenoids, Group : Squalenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 61.01 |
| 2 (CH) | 119.3 |
| 3 (C) | 142.39 |
| 4 (CH2) | 31.95 |
| 5 (CH2) | 26.08 |
| 6 (CH) | 124.69 |
| 7 (C) | 134.84 |
| 8 (CH2) | 31.68 |
| 9 (CH2) | 26.08 |
| 10 (CH) | 124.69 |
| 11 (C) | 134.84 |
| 12 (CH2) | 31.68 |
| 13 (CH2) | 26.08 |
| 14 (CH) | 124.69 |
| 15 (C) | 134.84 |
| 16 (CH2) | 39.42 |
| 17 (CH2) | 26.3 |
| 18 (CH) | 124.2 |
| 19 (C) | 134.4 |
| 20 (CH2) | 39.42 |
| 21 (CH2) | 26.38 |
| 22 (CH) | 124.15 |
| 23 (C) | 134.4 |
| 24 (CH3) | 25.51 |
| 25 (CH3) | 17.3 |
| 26 (CH3) | 15.54 |
| 27 (CH3) | 15.54 |
| 28 (CH3) | 22.87 |
| 29 (CH3) | 22.87 |
| 30 (CH3) | 22.87 |
| 1a (C) | 170.02 |
| 1b (CH3) | 20.57 |