Common Name: Lucidumoside A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H34O12/c1-3-15-16(10-19(28)34-9-8-13-4-6-14(27)7-5-13)17(23(32)33-2)12-35-24(15)37-25-22(31)21(30)20(29)18(11-26)36-25/h4-7,12,15-16,18,20-22,24-27,29-31H,3,8-11H2,1-2H3/t15-,16+,18-,20-,21+,22-,24+,25+/m1/s1
InChIKey: InChIKey=ZPYDXRKJBFBYGO-UCSVYGSWSA-N
Formula: C25H34O12
Molecular Weight: 526.531242
Exact Mass: 526.205027
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - He Z.D., Dong H., Xu H.X., Ye W.C., Sun H.D., But P.P. Phytochemistry (2001) 56, 327-30
Species:
Notes: Family : Terpenoids, Type : Monoterpenoids, Group : Iridoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 98.4 |
| 3 (CH) | 154 |
| 4 (C) | 110.4 |
| 5 (CH) | 30.8 |
| 6 (CH2) | 36.6 |
| 7 (C) | 174.1 |
| 8 (CH2) | 35 |
| 9 (CH) | 37.4 |
| 10 (CH3) | 14.3 |
| 1' (CH) | 100.6 |
| 2' (CH) | 74.7 |
| 3' (CH) | 77.9 |
| 4' (CH) | 71.5 |
| 5' (CH) | 78.3 |
| 6' (CH2) | 62.8 |
| 4a (C) | 168.6 |
| 4aa (CH3) | 51.8 |
| 7a (CH2) | 66.9 |
| 7b (CH2) | 35.1 |
| 7c (C) | 129.9 |
| 7d (CH) | 130.8 |
| 7e (CH) | 116.2 |
| 7f (C) | 156.9 |
| 7g (CH) | 116.2 |
| 7h (CH) | 130.8 |