Common Name: Lucidumoside B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H34O13/c1-3-13-14(9-19(29)35-7-6-12-4-5-16(27)17(28)8-12)15(23(33)34-2)11-36-24(13)38-25-22(32)21(31)20(30)18(10-26)37-25/h4-5,8,11,13-14,18,20-22,24-28,30-32H,3,6-7,9-10H2,1-2H3/t13-,14+,18-,20-,21+,22-,24+,25+/m1/s1
InChIKey: InChIKey=MPELAWXSOZTBPF-ASNPJKIBSA-N
Formula: C25H34O13
Molecular Weight: 542.530647
Exact Mass: 542.199941
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - He Z.D., Dong H., Xu H.X., Ye W.C., Sun H.D., But P.P. Phytochemistry (2001) 56, 327-30
Species:
Notes: Family : Terpenoids, Type : Monoterpenoids, Group : Iridoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 98.8 |
| 3 (CH) | 154.1 |
| 4 (C) | 110.7 |
| 5 (CH) | 30.9 |
| 6 (CH2) | 38.4 |
| 7 (C) | 174.2 |
| 8 (CH2) | 35.1 |
| 9 (CH) | 37.8 |
| 10 (CH3) | 14.3 |
| 1' (CH) | 100.9 |
| 2' (CH) | 74.6 |
| 3' (CH) | 78.1 |
| 4' (CH) | 71.8 |
| 5' (CH) | 78.3 |
| 6' (CH2) | 62.7 |
| 4a (C) | 168.9 |
| 4aa (CH3) | 51.7 |
| 7a (CH2) | 67 |
| 7b (CH2) | 36 |
| 7c (C) | 131.4 |
| 7d (CH) | 117 |
| 7e (C) | 146.8 |
| 7f (C) | 144.8 |
| 7g (CH) | 116.4 |
| 7h (CH) | 121.8 |