Common Name: 6-hydroxyluteolin-7-O-B-[2-O-B-xylopyranosylglucopyranoside]
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H26O15/c26-9-2-1-8(3-10(9)27)14-4-11(28)17-15(38-14)5-16(20(33)21(17)34)39-25-23(19(32)13(30)7-37-25)40-24-22(35)18(31)12(29)6-36-24/h1-5,12-13,18-19,22-27,29-35H,6-7H2/t12-,13-,18+,19+,22-,23-,24+,25+/m1/s1
InChIKey: InChIKey=DBKLYDRODYBAGT-FWCIWKIHSA-N
Formula: C25H26O15
Molecular Weight: 566.465931
Exact Mass: 566.12717
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Mitchell K.A., Markham K.R., Bayly M.J. Phytochemistry (2001) 56, 453-61
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 164.3 |
| 3 (CH) | 102.4 |
| 4 (C) | 192.3 |
| 5 (C) | 146.4 |
| 6 (C) | 130.7 |
| 7 (C) | 150.6 |
| 8 (CH) | 94.2 |
| 9 (C) | 148.8 |
| 10 (C) | 106.2 |
| 1' (C) | 121.5 |
| 2' (CH) | 113.4 |
| 3' (C) | 145.8 |
| 4' (C) | 149.8 |
| 5' (CH) | 116 |
| 6' (CH) | 119 |
| 1'' (CH) | 100.2 |
| 2'' (CH) | 82.1 |
| 3'' (CH) | 75.1 |
| 4'' (CH) | 68.8 |
| 5'' (CH2) | 65.8 |
| 1''' (CH) | 105.1 |
| 2''' (CH) | 74.1 |
| 3''' (CH) | 76 |
| 4''' (CH) | 69.3 |
| 5''' (CH2) | 65.8 |