Common Name: 6-hydroxyluteolin-7-O-B-[2-O-B-xylopyranosylglucopyranoside]
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H28O16/c27-6-16-20(34)22(36)24(42-25-23(37)18(32)12(31)7-38-25)26(41-16)40-15-5-14-17(21(35)19(15)33)11(30)4-13(39-14)8-1-2-9(28)10(29)3-8/h1-5,12,16,18,20,22-29,31-37H,6-7H2/t12-,16-,18+,20-,22+,23-,24-,25+,26-/m1/s1
InChIKey: InChIKey=JVTRUQCRQTYOFF-MXPJCCORSA-N
Formula: C26H28O16
Molecular Weight: 596.491953
Exact Mass: 596.137735
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Mitchell K.A., Markham K.R., Bayly M.J. Phytochemistry (2001) 56, 453-61
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 164.4 |
| 3 (CH) | 102.6 |
| 4 (C) | 182.4 |
| 5 (C) | 146.3 |
| 6 (C) | 130.9 |
| 7 (C) | 160.9 |
| 8 (CH) | 94.5 |
| 9 (C) | 149 |
| 10 (C) | 106.2 |
| 1' (C) | 121.6 |
| 2' (CH) | 113.5 |
| 3' (C) | 145.8 |
| 4' (C) | 149.8 |
| 5' (CH) | 116 |
| 6' (CH) | 119 |
| 1'' (CH) | 99.8 |
| 2'' (CH) | 82.6 |
| 3'' (CH) | 75.5 |
| 4'' (CH) | 69.2 |
| 5'' (CH) | 77.2 |
| 6'' (CH2) | 60.6 |
| 1''' (CH) | 105.2 |
| 2''' (CH) | 74.2 |
| 3''' (CH) | 76 |
| 4''' (CH) | 69.4 |
| 5''' (CH2) | 65.8 |