Common Name: Luteolin
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H28O15/c27-11-2-1-9(3-12(11)28)16-6-14(30)19-13(29)4-10(5-17(19)40-16)39-26-24(36)22(34)21(33)18(41-26)8-38-25-23(35)20(32)15(31)7-37-25/h1-6,15,18,20-29,31-36H,7-8H2/t15-,18-,20+,21-,22+,23-,24-,25+,26-/m1/s1
InChIKey: InChIKey=QOYOSTICCWYNER-AZQDDYIYSA-N
Formula: C26H28O15
Molecular Weight: 580.492548
Exact Mass: 580.14282
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Mitchell K.A., Markham K.R., Bayly M.J. Phytochemistry (2001) 56, 453-61
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 164.5 |
| 3 (CH) | 103.1 |
| 4 (C) | 181.8 |
| 5 (C) | 161.1 |
| 6 (CH) | 99.5 |
| 7 (C) | 162.9 |
| 8 (CH) | 94.7 |
| 9 (C) | 156.9 |
| 10 (C) | 105.3 |
| 1' (C) | 121.4 |
| 2' (CH) | 113.6 |
| 3' (C) | 145.7 |
| 4' (C) | 149.9 |
| 5' (CH) | 116 |
| 6' (CH) | 119.2 |
| 1'' (CH) | 99.9 |
| 2'' (CH) | 73 |
| 3'' (CH) | 76.2 |
| 4'' (CH) | 69.4 |
| 5'' (CH) | 75.5 |
| 6'' (CH2) | 68.2 |
| 1''' (CH) | 104 |
| 2''' (CH) | 73.3 |
| 3''' (CH) | 76.4 |
| 4''' (CH) | 69.3 |
| 5''' (CH2) | 65.6 |