Common Name: Bolusanthol C
Synonyms: Bolusanthol C
CAS Registry Number:
InChI: InChI=1S/C25H28O5/c1-14(2)5-7-17-11-16(8-10-20(17)26)19-13-30-22-12-21(27)18(9-6-15(3)4)24(28)23(22)25(19)29/h5-6,8,10-12,19,26-28H,7,9,13H2,1-4H3
InChIKey: InChIKey=CEBSROOTTDEPKN-UHFFFAOYSA-N
Formula: C25H28O5
Molecular Weight: 408.487763
Exact Mass: 408.193674
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Bojase G., Wanjala C.C., Majinda R.R. Phytochemistry (2001) 56, 837-41
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 71.8 |
| 3 (CH) | 51 |
| 4 (C) | 197.4 |
| 5 (C) | 162.1 |
| 6 (C) | 107.4 |
| 7 (C) | 164.2 |
| 8 (CH) | 95.6 |
| 9 (C) | 161.5 |
| 10 (C) | 103.3 |
| 1' (C) | 127.4 |
| 2' (CH) | 130.6 |
| 3' (C) | 127.8 |
| 4' (C) | 154.5 |
| 5' (CH) | 116.6 |
| 6' (CH) | 127.9 |
| 1'' (CH2) | 21.6 |
| 2'' (CH) | 121.8 |
| 3'' (C) | 135.9 |
| 4'' (CH3) | 18.3 |
| 5'' (CH3) | 26.2 |
| 1''' (CH2) | 30.2 |
| 2''' (CH) | 121.8 |
| 3''' (C) | 135.5 |
| 4''' (CH3) | 18.3 |
| 5''' (CH3) | 26.2 |