Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H26N2O4/c25-8-6-15-1-3-17(4-2-15)30-18-5-7-24-19-11-21-20(28-14-29-21)9-16(19)12-26(13-23(24)27)22(24)10-18/h1-5,7,9,11,18,22-23,27H,6,8,10,12-14,25H2/t18?,22?,23-,24+/m1/s1
InChIKey: InChIKey=WMQYROIEIDIUPE-KJMRNSNESA-N
Formula: C24H26N2O4
Molecular Weight: 406.475227
Exact Mass: 406.189257
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Elgorashi E.E., Drewes S.E., van Staden J. Phytochemistry (2001) 56, 637-40
Species:
Notes: Family : Alkaloids, Type : Isoquinolines; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 137.4 |
| 2 (CH) | 125.2 |
| 3 (CH) | 68.6 |
| 4 (CH2) | 34.7 |
| 6 (CH2) | 61.8 |
| 7 (CH) | 104.5 |
| 8 (C) | 147.9 |
| 9 (C) | 148.4 |
| 10 (CH) | 108.1 |
| 11 (CH) | 81.3 |
| 12 (CH2) | 63.9 |
| 3a (C) | 157.4 |
| 3b (CH) | 131 |
| 3c (CH) | 116.7 |
| 3d (C) | 130.9 |
| 3e (CH) | 116.7 |
| 3f (CH) | 131 |
| 3ad (CH2) | 37.9 |
| 3bd (CH2) | 44 |
| 4a (CH) | 67.7 |
| 6a (C) | 127.1 |
| 8a (CH2) | 102.4 |
| 10a (C) | 137.7 |
| 10b (C) | 51.7 |