Common Name: kushenol F
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H28O6/c1-13(2)5-6-15(14(3)4)9-18-20(28)11-23-24(25(18)30)21(29)12-22(31-23)17-8-7-16(26)10-19(17)27/h5,7-8,10-11,15,22,26-28,30H,3,6,9,12H2,1-2,4H3/t15?,22-/m0/s1
InChIKey: InChIKey=SUPRHWQIFJRUCQ-CEISFSOZSA-N
Formula: C25H28O6
Molecular Weight: 424.487168
Exact Mass: 424.188589
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - L.J. Wu, T. Miyase, A. Ueno, M. Kuroyanagi, T. Noro, S. Fukushima Yakugaku Zasshi (1985) 105, 736
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 73.3 |
| 3 (CH2) | 42.8 |
| 4 (C) | 197.5 |
| 5 (C) | 162.3 |
| 6 (C) | 108.4 |
| 7 (C) | 165.1 |
| 8 (CH) | 95.1 |
| 9 (C) | 162.9 |
| 10 (C) | 102.9 |
| 1' (C) | 117.6 |
| 2' (C) | 159.3 |
| 3' (CH) | 103.6 |
| 4' (C) | 156.2 |
| 5' (CH) | 107.9 |
| 6' (CH) | 128.7 |
| 6a (CH2) | 27.4 |
| 6b (CH) | 47.4 |
| 6c (C) | 149.1 |
| 6d (CH3) | 19.1 |
| 6e (CH2) | 111.1 |
| 6f (CH2) | 31.5 |
| 6g (CH) | 124.6 |
| 6h (C) | 131.3 |
| 6i (CH3) | 17.9 |
| 6j (CH3) | 25.8 |