Common Name: Kushenol E
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H28O6/c1-13(2)5-8-17-23(29)18(9-6-14(3)4)25-22(24(17)30)20(28)12-21(31-25)16-10-7-15(26)11-19(16)27/h5-7,10-11,21,26-27,29-30H,8-9,12H2,1-4H3
InChIKey: InChIKey=ZTEYEFPSJPSRRA-UHFFFAOYSA-N
Formula: C25H28O6
Molecular Weight: 424.487168
Exact Mass: 424.188589
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - L.J. Wu, T. Miyase, A. Ueno, M. Kuroyanagi, T. Noro and S. Fukushima Yakugaku Zasshi (1985) 105, 736
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 75.4 |
| 3 (CH2) | 42.9 |
| 4 (C) | 198.2 |
| 5 (C) | 159.3 |
| 6 (C) | 108.6 |
| 7 (C) | 162.4 |
| 8 (C) | 108 |
| 9 (C) | 160.2 |
| 10 (C) | 103.3 |
| 1' (C) | 117.9 |
| 2' (C) | 159.3 |
| 3' (CH) | 103.7 |
| 4' (C) | 156.2 |
| 5' (CH) | 107.9 |
| 6' (CH) | 128.6 |
| 6a (CH2) | 21.8 |
| 6b (CH) | 123.4 |
| 6c (C) | 134 |
| 6d (CH3) | 17.9 |
| 6e (CH3) | 25.8 |
| 8a (CH2) | 22.5 |
| 8b (CH) | 123.5 |
| 8c (C) | 132.2 |
| 8d (CH3) | 17.9 |
| 8e (CH3) | 25.8 |