Common Name: Sanggenon 1
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H26O6/c1-14(2)5-4-9-25(3)10-8-16-18(27)7-6-17(24(16)31-25)21-13-20(29)23-19(28)11-15(26)12-22(23)30-21/h5-8,10-12,21,26-28H,4,9,13H2,1-3H3
InChIKey: InChIKey=BVVVHQJFODXUQX-UHFFFAOYSA-N
Formula: C25H26O6
Molecular Weight: 422.471287
Exact Mass: 422.172939
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Y. Hano, T. Nomura Heterocycles (1983) 20, 1071
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 74.9 |
| 3 (CH2) | 42.7 |
| 4 (C) | 197.5 |
| 5 (C) | 165.3 |
| 6 (CH) | 96.8 |
| 7 (C) | 167.4 |
| 8 (CH) | 95.8 |
| 9 (C) | 164.8 |
| 10 (C) | 103.2 |
| 1' (C) | 118.3 |
| 2' (C) | 151.9 |
| 3' (C) | 110 |
| 4' (C) | 154.3 |
| 5' (CH) | 108.4 |
| 6' (CH) | 128.4 |
| 3'a (CH) | 118.2 |
| 3'b (CH) | 127.8 |
| 3'c (C) | 79.5 |
| 3'd (CH3) | 25.8 |
| 3'e (CH2) | 41.9 |
| 3'f (CH2) | 23.6 |
| 3'g (CH) | 125 |
| 3'h (C) | 131.5 |
| 3'i (CH3) | 17.9 |
| 3'j (CH3) | 25.8 |