Common Name: 4H-Naphtho(2,3-b)pyran-4-one, 2-phenyl-
Synonyms: 4H-Naphtho(2,3-b)pyran-4-one, 2-phenyl-
CAS Registry Number:
InChI: InChI=1S/C19H12O2/c20-17-12-18(13-6-2-1-3-7-13)21-19-11-15-9-5-4-8-14(15)10-16(17)19/h1-12H
InChIKey: InChIKey=KUHLNOSGIHMGFS-UHFFFAOYSA-N
Formula: C19H12O2
Molecular Weight: 272.298081
Exact Mass: 272.08373
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - P.J. Nathan, R.L. Santillan Spectrochem (1984) 40, 1077
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 163.5 |
| 3 (CH) | 105.6 |
| 4 (C) | 178.6 |
| 5 (CH) | 129.3 |
| 6 (C) | 130 |
| 7 (C) | 135.6 |
| 8 (CH) | 114 |
| 9 (C) | 152 |
| 10 (C) | 122.4 |
| 1' (C) | 121.5 |
| 2' (CH) | 128.8 |
| 3' (CH) | 131.5 |
| 4' (CH) | 128 |
| 5' (CH) | 131.5 |
| 6' (CH) | 128.8 |
| 6a (CH) | 128.4 |
| 6b (CH) | 125.7 |
| 6c (CH) | 126.3 |
| 6d (CH) | 126.9 |