Common Name: DiMNF
Synonyms: DiMNF
CAS Registry Number:
InChI: InChI=1S/C21H16O4/c1-23-18-10-8-14(11-20(18)24-2)19-12-17(22)16-9-7-13-5-3-4-6-15(13)21(16)25-19/h3-12H,1-2H3
InChIKey: InChIKey=QDZQDIUUJDAORK-UHFFFAOYSA-N
Formula: C21H16O4
Molecular Weight: 332.350126
Exact Mass: 332.104859
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - P.J. Nathan, R.L. Santillan Spectrochem (1984) 40, 1077
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 162.1 |
| 3 (CH) | 107.3 |
| 4 (C) | 177.7 |
| 5 (CH) | 120.5 |
| 6 (CH) | 128.8 |
| 7 (C) | 135.7 |
| 8 (C) | 119.9 |
| 9 (C) | 153 |
| 10 (C) | 123.8 |
| 1' (C) | 124 |
| 2' (CH) | 108.5 |
| 3' (C) | 149.1 |
| 4' (C) | 151.8 |
| 5' (CH) | 111.1 |
| 6' (CH) | 111.5 |
| 7a (CH) | 128 |
| 7b (CH) | 126.8 |
| 7c (CH) | 124.9 |
| 7d (CH) | 121.9 |
| 3'a (CH3) | 55.9 |
| 4'a (CH3) | 55.9 |