Common Name: 3',4'-Dihydroxy-5,7-dimethoxy-4-phenylcoumarin
Synonyms: 3',4'-Dihydroxy-5,7-dimethoxy-4-phenylcoumarin
CAS Registry Number:
InChI: InChI=1S/C17H14O6/c1-21-10-6-14(22-2)17-11(8-16(20)23-15(17)7-10)9-3-4-12(18)13(19)5-9/h3-8,18-19H,1-2H3
InChIKey: InChIKey=WRWXEWJZGBTCEB-UHFFFAOYSA-N
Formula: C17H14O6
Molecular Weight: 314.29011
Exact Mass: 314.079038
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Delle Monache G., Messana I., Botta B., Gacs-Baitz E. Magn Reson Chem (1989) 0, 1181
Species:
Notes: Family : Flavonoids, Type : Neoflavonoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 159.7 |
| 3 (CH) | 111.3 |
| 4 (C) | 155.5 |
| 5 (C) | 158.2 |
| 6 (CH) | 95.8 |
| 7 (C) | 163 |
| 8 (CH) | 93.7 |
| 9 (C) | 156.7 |
| 10 (C) | 103 |
| 1' (C) | 129.6 |
| 2' (CH) | 115.1 |
| 3' (C) | 144.2 |
| 4' (C) | 145.6 |
| 5' (CH) | 114.6 |
| 6' (CH) | 118.8 |
| 5a (CH3) | 55.6 |
| 7a (CH3) | 55.7 |