Common Name: Mammea A/AA dehydrocyclo F
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H24O5/c1-13(2)10-18(26)22-23(28)21-16(15-8-6-5-7-9-15)12-20(27)30-24(21)17-11-19(14(3)4)29-25(17)22/h5-9,12-13,19,28H,3,10-11H2,1-2,4H3/t19-/m1/s1
InChIKey: InChIKey=RFHMEYQQYUJGMP-LJQANCHMSA-N
Formula: C25H24O5
Molecular Weight: 404.456
Exact Mass: 404.162374
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Guilet D., Helesbeux J.J., Seraphin D., Sevenet T., Richomme P., Bruneton J. J Nat Prod (2001) 64, 563-8
Species:
Notes: Family : Flavonoids, Type : Neoflavonoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 159.7 |
| 3 (CH) | 111.9 |
| 4 (C) | 156.5 |
| 5 (C) | 164.5 |
| 6 (C) | 103.2 |
| 7 (C) | 164.5 |
| 8 (C) | 104.5 |
| 9 (C) | 155.6 |
| 10 (C) | 102.2 |
| 1' (C) | 139 |
| 2' (CH) | 127.1 |
| 3' (CH) | 127.5 |
| 4' (CH) | 128.1 |
| 5' (CH) | 127.5 |
| 6' (CH) | 127.1 |
| 6a (C) | 205.3 |
| 6b (CH2) | 51.7 |
| 6c (CH) | 25.3 |
| 6d (CH3) | 22.5 |
| 6ca (CH3) | 22.5 |
| 8a (CH2) | 30.5 |
| 8b (CH) | 89.1 |
| 8c (C) | 142.2 |
| 8d (CH3) | 17.1 |
| 8ca (CH2) | 113.2 |