Common Name: Mammea A/BB
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H26O5/c1-5-15(4)22(27)21-24(29)17(12-11-14(2)3)23(28)20-18(13-19(26)30-25(20)21)16-9-7-6-8-10-16/h6-11,13,15,28-29H,5,12H2,1-4H3
InChIKey: InChIKey=ZZRRSYITGMMRPP-UHFFFAOYSA-N
Formula: C25H26O5
Molecular Weight: 406.471882
Exact Mass: 406.178024
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Morel C., Guilet D., Oger J.M., Seraphin D., Sevenet T., Wiart C., Hadi A.H.A., Richomme P., Bruneton J. Phytochemistry (1999) 50, 1243
Species:
Notes: Family : Flavonoids, Type : Neoflavonoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 159.2 |
| 3 (CH) | 112.1 |
| 4 (C) | 154.1 |
| 5 (C) | 157 |
| 6 (C) | 112.6 |
| 7 (C) | 166.9 |
| 8 (C) | 104.1 |
| 9 (C) | 155.7 |
| 10 (C) | 100.5 |
| 1' (C) | 136.8 |
| 2' (CH) | 127.5 |
| 3' (CH) | 129.5 |
| 4' (CH) | 130.2 |
| 5' (CH) | 129.5 |
| 6' (CH) | 127.5 |
| 6a (CH2) | 21.6 |
| 6b (CH) | 120.8 |
| 6c (C) | 134.1 |
| 6d (CH3) | 25.6 |
| 6ca (CH3) | 17.9 |
| 8a (C) | 210.1 |
| 8b (CH) | 47 |
| 8c (CH2) | 27.2 |
| 8d (CH3) | 11.8 |
| 8ba (CH3) | 16.6 |