Common Name: Teysmanone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H26O5/c1-14(2)11-12-18-24(29-5)21-19(17-9-7-6-8-10-17)13-20(27)31-26(21)22-23(28)15(3)16(4)30-25(18)22/h6-11,13,15-16H,12H2,1-5H3/t15-,16-/m0/s1
InChIKey: InChIKey=DJQOFJYLUOKIRR-HOTGVXAUSA-N
Formula: C26H26O5
Molecular Weight: 418.482618
Exact Mass: 418.178024
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Cao S.G., Sim K.Y., Pereira J., Goh S.H. Phytochemistry (1998) 47, 1051
Species:
Notes: Family : Flavonoids, Type : Neoflavonoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 159.5 |
| 3 (CH) | 114.7 |
| 4 (C) | 154.4 |
| 5 (C) | 163.2 |
| 6 (C) | 120.8 |
| 7 (C) | 160.4 |
| 8 (C) | 106.4 |
| 9 (C) | 153.7 |
| 10 (C) | 107.2 |
| 1' (C) | 138.4 |
| 2' (CH) | 127.4 |
| 3' (CH) | 127.7 |
| 4' (CH) | 128.5 |
| 5' (CH) | 127.7 |
| 6' (CH) | 127.4 |
| 5a (CH3) | 62 |
| 6a (CH2) | 22.6 |
| 6b (CH) | 121.7 |
| 6c (C) | 132.2 |
| 6d (CH3) | 25.6 |
| 6ca (CH3) | 17.8 |
| 8a (C) | 190.7 |
| 8b (CH) | 47.2 |
| 8c (CH) | 79.5 |
| 8d (CH3) | 19.5 |
| 8ca (CH3) | 10.4 |