Common Name: Furanoracemosone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H16O5/c1-2-6-15(22)18-19(24)17-14(12-7-4-3-5-8-12)11-16(23)26-21(17)13-9-10-25-20(13)18/h3-5,7-11,24H,2,6H2,1H3
InChIKey: InChIKey=WUIYLXXBSXOSSJ-UHFFFAOYSA-N
Formula: C21H16O5
Molecular Weight: 348.349531
Exact Mass: 348.099774
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Morel C., Dartiguelongue C., Youhana T., Oger J.M., Seraphin D., Duval O., Richomme P., Bruneton J. Heterocycles (1999) 51, 2183
Species:
Notes: Family : Flavonoids, Type : Neoflavonoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 159.3 |
| 3 (CH) | 114.3 |
| 4 (C) | 156.8 |
| 5 (C) | 162.7 |
| 6 (C) | 103.7 |
| 7 (C) | 156 |
| 8 (C) | 104.7 |
| 9 (C) | 143.9 |
| 10 (C) | 104.7 |
| 1' (C) | 138.9 |
| 2' (CH) | 127.2 |
| 3' (CH) | 127.7 |
| 4' (CH) | 128.4 |
| 5' (CH) | 127.7 |
| 6' (CH) | 127.2 |
| 6a (C) | 204.5 |
| 6b (CH2) | 44.9 |
| 6c (CH2) | 17.5 |
| 6d (CH3) | 13.8 |
| 8a (CH) | 109.7 |
| 8b (CH) | 153.3 |