Common Name: Saletpangponoside A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C34H44O19/c1-14(37)53-34(2)10-18(22-17(30(45)46-3)13-47-31(23(22)34)52-33-29(44)27(42)25(40)20(12-36)51-33)49-21(38)9-6-15-4-7-16(8-5-15)48-32-28(43)26(41)24(39)19(11-35)50-32/h4-9,13,18-20,22-29,31-33,35-36,39-44H,10-12H2,1-3H3/b9-6+/t18-,19-,20-,22+,23-,24-,25-,26+,27+,28-,29-,31+,32-,33+,34+/m1/s1
InChIKey: InChIKey=HHIBYENHLKOCEO-ATCKIDBWSA-N
Formula: C34H44O19
Molecular Weight: 756.703107
Exact Mass: 756.247679
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Kanchanapoom, T., Kasai, R., Chumsri, P., Hiraga, Y., Yamasaki, K. Phytochemistry (2001) 58, 333-6
Species:
Notes: Family : Terpenoids, Type : Monoterpenoids, Group : Iridoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 95.4 |
| 3 (CH) | 154.5 |
| 4 (C) | 108.5 |
| 5 (CH) | 39.9 |
| 6 (CH) | 78.9 |
| 7 (CH2) | 45.1 |
| 8 (C) | 89.6 |
| 9 (CH) | 50.3 |
| 10 (CH3) | 21.8 |
| 11 (C) | 168.4 |
| 1' (CH) | 100.3 |
| 2' (CH) | 74.6 |
| 3' (CH) | 77.9 |
| 4' (CH) | 71.6 |
| 5' (CH) | 78.3 |
| 6' (CH2) | 62.9 |
| 1'' (CH) | 101.8 |
| 2'' (CH) | 74.8 |
| 3'' (CH) | 77.9 |
| 4'' (CH) | 71.2 |
| 5'' (CH) | 78.1 |
| 6'' (CH2) | 62.4 |
| 6a (C) | 168.1 |
| 6b (CH) | 117.2 |
| 6c (CH) | 145.9 |
| 6d (C) | 129.8 |
| 6e (CH) | 130.8 |
| 6f (CH) | 118 |
| 6g (C) | 160.9 |
| 6h (CH) | 118 |
| 6i (CH) | 130.8 |
| 8a (C) | 172.9 |
| 8b (CH3) | 22.3 |
| 11a (CH3) | 51.9 |