Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H24N2O7/c1-25-9-14-20(23(26)27)19(11-5-17(28-2)22(30-4)18(6-11)29-3)12-7-15-16(32-10-31-15)8-13(12)21(14)24-25/h5-8,14,19-20H,9-10H2,1-4H3,(H,26,27)/t14-,19+,20-/m0/s1
InChIKey: InChIKey=PROZGXOCVVNDNF-KPOBHBOGSA-N
Formula: C23H24N2O7
Molecular Weight: 440.446824
Exact Mass: 440.158351
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Castro, M.A., Miguel del Corral, M., Lopez-Vazquez, L., Garcia, P.A., San Feliciano, A. Magn Reson Chem (1985) 23, 389
Species:
Notes: Family : Lignans, Type : Lignans, Group : Cyclolignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 122.1 |
| 2 (C) | 133.9 |
| 3 (CH) | 109.2 |
| 4 (C) | 149.6 |
| 5 (C) | 147.6 |
| 6 (CH) | 103.4 |
| 7 (C) | 152.8 |
| 8 (CH) | 41.9 |
| 9 (CH2) | 62.7 |
| 1' (C) | 135.5 |
| 2' (CH) | 107.1 |
| 3' (C) | 153 |
| 4' (C) | 137.6 |
| 5' (C) | 153 |
| 6' (CH) | 107.1 |
| 7' (CH) | 47.9 |
| 8' (CH) | 50.3 |
| 9' (C) | 178 |
| 4a (CH2) | 101.5 |
| 9a (CH3) | 43.7 |
| 3'a (CH3) | 56.2 |
| 4'a (CH3) | 60.7 |
| 5'a (CH3) | 56.2 |