Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H25NO9/c1-13(27)35-26-11-16-6-14-7-18-19(34-12-33-18)10-17(14)22(23(16)25(28)32-5)15-8-20(29-2)24(31-4)21(9-15)30-3/h6-11,22-23H,12H2,1-5H3/b26-11+/t22-,23-/m1/s1
InChIKey: InChIKey=LAIGKKZGAYOYAJ-IXYPFZPMSA-N
Formula: C25H25N1O9
Molecular Weight: 483.468304
Exact Mass: 483.152931
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Castro, M.A., Miguel del Corral, M., Lopez-Vazquez, L., Garcia, P.A., San Feliciano, A. Magn Reson Chem (1985) 23, 389
Species:
Notes: Family : Lignans, Type : Lignans, Group : Cyclolignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 131.7 |
| 2 (C) | 126.8 |
| 3 (CH) | 109.8 |
| 4 (C) | 148.6 |
| 5 (C) | 147.1 |
| 6 (CH) | 107.3 |
| 7 (CH) | 133.3 |
| 8 (C) | 126.4 |
| 9 (CH) | 151.5 |
| 1' (C) | 138.3 |
| 2' (CH) | 105.1 |
| 3' (C) | 153.5 |
| 4' (C) | 137.7 |
| 5' (C) | 153.5 |
| 6' (CH) | 105.1 |
| 7' (CH) | 46.6 |
| 8' (CH) | 46.6 |
| 9' (C) | 172.4 |
| 4a (CH2) | 101.2 |
| 9a (C) | 170.5 |
| 9b (CH3) | 20.7 |
| 3'a (CH3) | 56.7 |
| 4'a (CH3) | 60.7 |
| 5'a (CH3) | 56.7 |
| 9'a (CH3) | 52.8 |