Common Name: (5R)-5,6,7,8-Tetrahydro-5beta-(3,4,5-trimethoxyphenyl)-7-formylnaphtho[2,3-d]-1,3-dioxole-6alpha-carboxylic acid methyl ester
Synonyms: (5R)-5,6,7,8-Tetrahydro-5beta-(3,4,5-trimethoxyphenyl)-7-formylnaphtho[2,3-d]-1,3-dioxole-6alpha-carboxylic acid methyl ester
CAS Registry Number:
InChI: InChI=1S/C23H24O8/c1-26-18-7-13(8-19(27-2)22(18)28-3)20-15-9-17-16(30-11-31-17)6-12(15)5-14(10-24)21(20)23(25)29-4/h6-10,14,20-21H,5,11H2,1-4H3/t14?,20-,21-/m1/s1
InChIKey: InChIKey=SLFDZSGCEBRAPV-BUXZTTEJSA-N
Formula: C23H24O8
Molecular Weight: 428.432743
Exact Mass: 428.147118
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Castro, M.A., Miguel del Corral, M., Lopez-Vazquez, L., Garcia, P.A., San Feliciano, A. Magn Reson Chem (1985) 23, 389
Species:
Notes: Family : Lignans, Type : Lignans, Group : Cyclolignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 127.5 |
| 2 (C) | 128.6 |
| 3 (CH) | 109.8 |
| 4 (C) | 147 |
| 5 (C) | 146.6 |
| 6 (CH) | 108.3 |
| 7 (CH2) | 26.6 |
| 8 (CH) | 33 |
| 9 (CH) | 201.9 |
| 1' (C) | 140.3 |
| 2' (CH) | 106.6 |
| 3' (C) | 153.4 |
| 4' (C) | 138.3 |
| 5' (C) | 153.4 |
| 6' (CH) | 106.6 |
| 7' (CH) | 46.4 |
| 8' (CH) | 48.1 |
| 9' (C) | 172.1 |
| 4a (CH2) | 100.9 |
| 3'a (CH3) | 56.3 |
| 4'a (CH3) | 60.7 |
| 5'a (CH3) | 56.3 |
| 9'a (CH3) | 52 |