Common Name: epi-Sarcotrine C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C30H45NO4/c1-7-21(2)20-31-18-17-26(29(31)33)16-10-14-23(4)12-8-11-22(3)13-9-15-24(5)19-27-28(32)25(6)30(34)35-27/h8,11-12,15,17,21-22,27,32H,7,9-10,13-14,16,18-20H2,1-6H3/b11-8+,23-12+,24-15-/t21?,22-,27-/m1/s1
InChIKey: InChIKey=YVPHTXBDJHDSKU-HZZXTSAPSA-N
Formula: C30H45N1O4
Molecular Weight: 483.683774
Exact Mass: 483.334859
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Liu, Y., Hong, J., Lee, C.O., Im, K.S., Kim, N.D., Choi, J.S., Jung, J.H. J Nat Prod (2002) 65, 1307-14
Species:
Notes: Family : Terpenoids, Type : Sesterterpenoids, Group : Acyclics; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 52.2 |
| 2 (CH) | 137.6 |
| 3 (C) | 140.4 |
| 4 (C) | 173.7 |
| 5 (CH2) | 26.3 |
| 6 (CH2) | 26.9 |
| 7 (CH2) | 40.4 |
| 8 (C) | 136.4 |
| 9 (CH3) | 16.4 |
| 10 (CH) | 126.5 |
| 11 (CH) | 126.7 |
| 12 (CH) | 139.3 |
| 13 (CH) | 38 |
| 14 (CH3) | 21.4 |
| 15 (CH2) | 38.4 |
| 16 (CH2) | 27 |
| 17 (CH) | 129.6 |
| 18 (C) | 131.8 |
| 19 (CH3) | 24.3 |
| 20 (CH2) | 35.8 |
| 21 (CH) | 80.3 |
| 22 (C) | 182 |
| 23 (C) | 92.3 |
| 24 (C) | 186.2 |
| 25 (CH3) | 6 |
| 1a (CH2) | 49.5 |
| 1b (CH) | 35.8 |
| 1c (CH2) | 28 |
| 1d (CH3) | 11.5 |
| 1e (CH3) | 17 |