Common Name: Geranylgeranylhydroquinone
Synonyms: Geranylgeranylhydroquinone
CAS Registry Number:
InChI: InChI=1S/C26H38O2/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-14-23(5)15-16-24-19-25(27)17-18-26(24)28/h9,11,13,15,17-19,27-28H,6-8,10,12,14,16H2,1-5H3/b21-11+,22-13+,23-15+
InChIKey: InChIKey=FIPAQYYZFDCRDD-FPFQZNTGSA-N
Formula: C26H38O2
Molecular Weight: 382.579692
Exact Mass: 382.28718
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Vidari, G., Vita-Finzi, P., Zanocchi, A.M., Noy, G.P. J Nat Prod (1995) 58, 893-6
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Phytanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 29.6 |
| 2 (CH) | 121.1 |
| 3 (C) | 138.6 |
| 4 (CH2) | 39.5 |
| 5 (CH2) | 26.6 |
| 6 (CH) | 123.6 |
| 7 (C) | 135.5 |
| 8 (CH2) | 39.6 |
| 9 (CH2) | 26.5 |
| 10 (CH) | 124.1 |
| 11 (C) | 134.9 |
| 12 (CH2) | 39.6 |
| 13 (CH2) | 26.3 |
| 14 (CH) | 124.3 |
| 15 (C) | 131.2 |
| 16 (CH3) | 25.6 |
| 17 (CH3) | 17.6 |
| 18 (CH3) | 15.9 |
| 19 (CH3) | 16 |
| 20 (CH3) | 16.1 |
| 1a (C) | 128.1 |
| 1b (C) | 148.1 |
| 1c (CH) | 116.4 |
| 1d (CH) | 113.6 |
| 1e (C) | 149.2 |
| 1f (CH) | 116.4 |