Common Name: Gnetupendin B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H20O6/c1-28-22-10-13(3-7-19(22)25)2-5-15-11-16(23)12-20(26)17(15)8-14-4-6-18(24)21(27)9-14/h2-7,9-12,23-27H,8H2,1H3/b5-2+
InChIKey: InChIKey=DHOWKHPVWVNKPP-GORDUTHDSA-N
Formula: C22H20O6
Molecular Weight: 380.391434
Exact Mass: 380.125988
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Li, X.M., Wang, Y.H., Lin, M. Phytochemistry (2001) 58, 591-4
Species:
Notes: Family : Aromatics, Type : Stilbenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 130.7 |
| 2 (CH) | 109.7 |
| 3 (C) | 148.4 |
| 4 (C) | 147.3 |
| 5 (CH) | 115.8 |
| 6 (CH) | 121.1 |
| 7 (CH) | 130.1 |
| 8 (CH) | 125.1 |
| 9 (C) | 139.5 |
| 10 (C) | 104.1 |
| 11 (C) | 157 |
| 12 (CH) | 102.5 |
| 13 (C) | 157 |
| 14 (CH) | 118.3 |
| 15 (CH2) | 30.5 |
| 16 (C) | 134.9 |
| 17 (CH) | 120.3 |
| 18 (C) | 145.6 |
| 19 (C) | 143.5 |
| 20 (CH) | 115.7 |
| 21 (CH) | 116.2 |
| 3a (CH3) | 56.1 |