Common Name: Dinklagin B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H18O6/c1-20(2)17(23)7-12-15(26-20)9-16-18(19(12)24)13(22)8-14(25-16)10-3-5-11(21)6-4-10/h3-6,8-9,17,21,23-24H,7H2,1-2H3
InChIKey: InChIKey=FJVQQAWOOLFVQM-UHFFFAOYSA-N
Formula: C20H18O6
Molecular Weight: 354.354081
Exact Mass: 354.110338
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Ngadjui B.T., Dongo E., Abegaz B.M., Fotso S., Tamboue H. Phytochemistry (2002) 61, 99-104
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 164.6 |
| 3 (CH) | 103.3 |
| 4 (C) | 182.7 |
| 5 (C) | 159.8 |
| 6 (C) | 104.5 |
| 7 (C) | 161.2 |
| 8 (CH) | 94.9 |
| 9 (C) | 156 |
| 10 (C) | 104.4 |
| 1' (C) | 122.9 |
| 2' (CH) | 128.8 |
| 3' (CH) | 116.4 |
| 4' (C) | 159.9 |
| 5' (CH) | 116.4 |
| 6' (CH) | 128.8 |
| 6a (CH2) | 20.7 |
| 6b (CH) | 68.4 |
| 6c (C) | 79.2 |
| 6ca (CH3) | 25.3 |
| 6cb (CH3) | 25.5 |