Common Name: Pinocembrin 7-O-a-arabinopyranosyl-(1?2)-b-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H30O13/c27-9-18-21(32)22(33)24(39-25-23(34)20(31)15(30)10-35-25)26(38-18)36-12-6-13(28)19-14(29)8-16(37-17(19)7-12)11-4-2-1-3-5-11/h1-7,15-16,18,20-28,30-34H,8-10H2/t15-,16?,18+,20-,21+,22-,23+,24+,25-,26+/m0/s1
InChIKey: InChIKey=MWXORMKINOZEQF-PGUNIBAKSA-N
Formula: C26H30O13
Molecular Weight: 550.50962
Exact Mass: 550.168641
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Flamini G., Pardini M., Morelli I., Ertugrul K., Dural H., Bagci Y., Kargioglu M. Phytochemistry (2002) 61, 433-7
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 78.7 |
| 3 (CH2) | 42.3 |
| 4 (C) | 196.9 |
| 5 (C) | 163 |
| 6 (CH) | 96.7 |
| 7 (C) | 165.1 |
| 8 (CH) | 95.6 |
| 9 (C) | 162.6 |
| 10 (C) | 103.4 |
| 1' (C) | 138.5 |
| 2' (CH) | 126.8 |
| 3' (CH) | 128.7 |
| 4' (CH) | 132.1 |
| 5' (CH) | 128.7 |
| 6' (CH) | 126.8 |
| 1'' (CH) | 98 |
| 2'' (CH) | 81.2 |
| 3'' (CH) | 77 |
| 4'' (CH) | 69.2 |
| 5'' (CH) | 76.1 |
| 6'' (CH2) | 60.5 |
| 1''' (CH) | 104 |
| 2''' (CH) | 71.2 |
| 3''' (CH) | 69.2 |
| 4''' (CH) | 66.7 |
| 5''' (CH2) | 64.1 |