Common Name: Patuletin 7-O-[6''-(2-methylbutyryl)]glucoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C27H30O14/c1-4-10(2)26(36)38-9-16-18(30)21(33)23(35)27(41-16)40-15-8-14-17(20(32)25(15)37-3)19(31)22(34)24(39-14)11-5-6-12(28)13(29)7-11/h5-8,10,16,18,21,23,27-30,32-35H,4,9H2,1-3H3/t10?,16-,18-,21+,23-,27-/m1/s1
InChIKey: InChIKey=SFYSEZGEYNZKDD-DUMLXZITSA-N
Formula: C27H30O14
Molecular Weight: 578.519761
Exact Mass: 578.163556
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Park, E.J., Kim, Y., Kim, J. J Nat Prod (2000) 63, 34-6
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 150 |
| 3 (C) | 138.2 |
| 4 (C) | 178.5 |
| 5 (C) | 153.9 |
| 6 (C) | 134.3 |
| 7 (C) | 158.2 |
| 8 (CH) | 96.2 |
| 9 (C) | 154 |
| 10 (C) | 107.6 |
| 1' (C) | 124.7 |
| 2' (CH) | 117 |
| 3' (C) | 147.2 |
| 4' (C) | 149.9 |
| 5' (CH) | 117 |
| 6' (CH) | 122.6 |
| 1'' (CH) | 102.4 |
| 2'' (CH) | 75.5 |
| 3'' (CH) | 78.7 |
| 4'' (CH) | 72.6 |
| 5'' (CH) | 76.5 |
| 6'' (CH2) | 65.8 |
| 6a (CH3) | 62.3 |
| 6''a (C) | 179 |
| 6''b (CH) | 43 |
| 6''c (CH3) | 17.8 |
| 6''d (CH2) | 28.5 |
| 6''e (CH3) | 12.4 |