Common Name: 7, 5'-Dihydroxy-3'-methoxy-isoflavone-7-O-Beta-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H22O10/c1-29-13-5-10(4-11(24)6-13)15-9-30-16-7-12(2-3-14(16)18(15)25)31-22-21(28)20(27)19(26)17(8-23)32-22/h2-7,9,17,19-24,26-28H,8H2,1H3/t17-,19-,20+,21-,22-/m1/s1
InChIKey: InChIKey=MMZAWANLDLVWNL-MIUGBVLSSA-N
Formula: C22H22O10
Molecular Weight: 446.404936
Exact Mass: 446.121297
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Du, X., Bai, Y., Liang, H., Wang, Z., Zhao, Y., Zhang, Q., Huang, L. Magn Reson Chem (2006) 44, 708-12
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 153.4 |
| 3 (C) | 124.4 |
| 4 (C) | 174.5 |
| 5 (CH) | 126.9 |
| 6 (CH) | 115.5 |
| 7 (C) | 161.3 |
| 8 (CH) | 103.4 |
| 9 (C) | 156.9 |
| 10 (C) | 118.4 |
| 1' (C) | 123.5 |
| 2' (CH) | 112 |
| 3' (C) | 146 |
| 4' (CH) | 116.4 |
| 5' (C) | 147.5 |
| 6' (CH) | 119.6 |
| 1'' (CH) | 100 |
| 2'' (CH) | 73.1 |
| 3'' (CH) | 76.4 |
| 4'' (CH) | 69.6 |
| 5'' (CH) | 77.1 |
| 6'' (CH2) | 60.6 |
| 3'b (CH3) | 55.7 |