Common Name: Luzonoside D
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H32O12/c1-34-24(33)17-12-36-25(38-26-23(32)22(31)21(30)18(10-27)37-26)20-14(5-8-16(17)20)11-35-19(29)9-4-13-2-6-15(28)7-3-13/h2-4,6-7,9,12,14,16,18,20-23,25-28,30-32H,5,8,10-11H2,1H3/b9-4-/t14-,16-,18-,20-,21-,22+,23-,25+,26+/m1/s1
InChIKey: InChIKey=COQOXCPEJJIULA-YITUERRASA-N
Formula: C26H32O12
Molecular Weight: 536.526097
Exact Mass: 536.189376
NMR Solvent: M+M
MHz:
Calibration:
NMR references: 13C - Fukuyama, Y., Minoshima, Y., Kishimoto, Y., Chen, I.S., Takahashi, H., Esumi, T. J Nat Prod (2004) 67, 1833-8
Species:
Notes: Family : Terpenoids, Type : Monoterpenoids, Group : Iridoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 98.4 |
| 3 (CH) | 153.5 |
| 4 (C) | 111.8 |
| 5 (CH) | 36.8 |
| 6 (CH2) | 33.5 |
| 7 (CH2) | 28.6 |
| 8 (CH) | 41 |
| 9 (CH) | 44.3 |
| 10 (CH2) | 68.3 |
| 11 (C) | 169.6 |
| 1' (CH) | 100.5 |
| 2' (CH) | 74.7 |
| 3' (CH) | 78 |
| 4' (CH) | 71.5 |
| 5' (CH) | 78.4 |
| 6' (CH2) | 62.7 |
| 10a (C) | 169.6 |
| 10b (CH) | 117 |
| 10c (CH) | 144.9 |
| 10d (C) | 127.8 |
| 10e (CH) | 133.3 |
| 10f (CH) | 115.9 |
| 10g (C) | 161.4 |
| 10h (CH) | 115.9 |
| 10i (CH) | 133.3 |
| 11a (CH3) | 51.7 |