Common Name: 6-Hydroxyluteolin 4'-methyl ether 7-O-a-rhamnopyranosyl(1'''-->2''')[6''-O-acetyl- -glucopyranoside]
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C30H34O17/c1-10-21(34)25(38)27(40)29(43-10)47-28-26(39)23(36)19(9-42-11(2)31)46-30(28)45-18-8-17-20(24(37)22(18)35)14(33)7-16(44-17)12-4-5-15(41-3)13(32)6-12/h4-8,10,19,21,23,25-30,32,34-40H,9H2,1-3H3/t10-,19+,21-,23+,25+,26-,27+,28+,29-,30+/m0/s1
InChIKey: InChIKey=NSOHGASIQJMBNH-RLYKLETASA-N
Formula: C30H34O17
Molecular Weight: 666.581946
Exact Mass: 666.1796
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Albach, D.C., Grayer, R.J., Jensen, S.R., Ozgokce, F., Veitch, N.C. Phytochemistry (2003) 64, 1295-301
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 163.8 |
| 3 (CH) | 103.1 |
| 4 (C) | 182.1 |
| 5 (C) | 146.8 |
| 6 (C) | 130.7 |
| 7 (C) | 151.2 |
| 8 (CH) | 93.8 |
| 9 (C) | 149 |
| 10 (C) | 105.5 |
| 1' (C) | 123.1 |
| 2' (CH) | 113 |
| 3' (C) | 146.7 |
| 4' (C) | 151.1 |
| 5' (CH) | 112.1 |
| 6' (CH) | 118.5 |
| 1'' (CH) | 97.7 |
| 2'' (CH) | 77.1 |
| 3'' (CH) | 76.8 |
| 4'' (CH) | 69.8 |
| 5'' (CH) | 73.7 |
| 6'' (CH2) | 63.2 |
| 1''' (CH) | 100.5 |
| 2''' (CH) | 70.3 |
| 3''' (CH) | 70.3 |
| 4''' (CH) | 72 |
| 5''' (CH) | 68.6 |
| 6''' (CH3) | 17.8 |
| 4'a (CH3) | 55.7 |
| 6''b (C) | 169.9 |
| 6''c (CH3) | 20.4 |