Common Name: 2H-1-Benzopyran-2-one, 5,7-dihydroxy-4-(2-hydroxyphenyl)-
Synonyms: 2H-1-Benzopyran-2-one, 5,7-dihydroxy-4-(2-hydroxyphenyl)-
CAS Registry Number:
InChI: InChI=1S/C15H10O5/c16-8-5-12(18)15-10(7-14(19)20-13(15)6-8)9-3-1-2-4-11(9)17/h1-7,16-18H
InChIKey: InChIKey=STTFUJUCFPJSOI-UHFFFAOYSA-N
Formula: C15H10O5
Molecular Weight: 270.237471
Exact Mass: 270.052823
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Iluma, I., Tanaka, T., Hamada, K., Mizuno, M., Asai, F. Chem Pharm Bull (1987) 35, 3909
Species:
Notes: Family : Flavonoids, Type : Neoflavonoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 160.5 |
| 3 (CH) | 110.1 |
| 4 (C) | 154.4 |
| 5 (C) | 156.6 |
| 6 (CH) | 99 |
| 7 (C) | 161.4 |
| 8 (CH) | 94.4 |
| 9 (C) | 157.6 |
| 10 (C) | 102.6 |
| 1' (C) | 127.9 |
| 2' (C) | 154.2 |
| 3' (CH) | 114.2 |
| 4' (CH) | 128.9 |
| 5' (CH) | 118.4 |
| 6' (CH) | 128.3 |