Common Name: 5-hydroxy-8,8-dimethyl-4-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one
Synonyms: 5-hydroxy-8,8-dimethyl-4-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one
CAS Registry Number:
InChI: InChI=1S/C20H18O4/c1-20(2)9-8-13-16(24-20)11-15(21)18-14(10-17(22)23-19(13)18)12-6-4-3-5-7-12/h3-7,10-11,21H,8-9H2,1-2H3
InChIKey: InChIKey=BDWAFTUVPZWXIV-UHFFFAOYSA-N
Formula: C20H18O4
Molecular Weight: 322.355271
Exact Mass: 322.120509
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Lopez-Perez, J.L., Olmedo, D.A., Del Olmo, E., Vasquez, Y., Solis, P.N., Gupta, M.P., San Feliciano, A. J Nat Prod (2005) 68, 369-73
Species:
Notes: Family : Flavonoids, Type : Neoflavonoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 161.2 |
| 3 (CH) | 111.3 |
| 4 (C) | 155 |
| 5 (C) | 153.4 |
| 6 (CH) | 100.8 |
| 7 (C) | 158.3 |
| 8 (C) | 102 |
| 9 (C) | 153.6 |
| 10 (C) | 101 |
| 1' (C) | 138 |
| 2' (CH) | 127.4 |
| 3' (CH) | 128.7 |
| 4' (CH) | 129.1 |
| 5' (CH) | 128.7 |
| 6' (CH) | 127.4 |
| 8a (CH2) | 16.4 |
| 8b (CH2) | 31.8 |
| 8c (C) | 75.9 |
| 8d (CH3) | 26.5 |
| 8e (CH3) | 26.5 |