Common Name: 5-O-b-D-glucopyranosyl-4-(4-hydroxyphenyl)-7-methoxy-2H-chromen-2-one
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H22O9/c1-28-12-7-14-18(13(9-17(24)29-14)11-5-3-2-4-6-11)15(8-12)30-22-21(27)20(26)19(25)16(10-23)31-22/h2-9,16,19-23,25-27H,10H2,1H3/t16-,19-,20+,21-,22-/m1/s1
InChIKey: InChIKey=JTKGBGDTRWEGCE-RECXWPGBSA-N
Formula: C22H22O9
Molecular Weight: 430.405531
Exact Mass: 430.126382
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Olmedo, D., Rodriguez, N., Vasquez, Y., Solis, P.N., Lopez-Perez, J.L., Feliciano, A.S., Gupta, M.P. J Nat Prod Res (2007) 21, 625-31
Species:
Notes: Family : Flavonoids, Type : Neoflavonoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 159.9 |
| 3 (CH) | 112.5 |
| 4 (C) | 155.9 |
| 5 (C) | 156.2 |
| 6 (CH) | 98.4 |
| 7 (C) | 163.1 |
| 8 (CH) | 95.5 |
| 9 (C) | 103.7 |
| 10 (C) | 156.7 |
| 1' (C) | 130 |
| 2' (CH) | 129.7 |
| 3' (CH) | 114.4 |
| 4' (CH) | 157.9 |
| 5' (CH) | 114.4 |
| 6' (CH) | 129.7 |
| 1'' (CH) | 100.1 |
| 2'' (CH) | 73 |
| 3'' (CH) | 76.8 |
| 4'' (CH) | 70 |
| 5'' (CH) | 77.5 |
| 6'' (CH2) | 61 |
| 7a (CH3) | 56.2 |