Common Name: Cowaxanthone E
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H26O7/c1-12(2)6-8-14-19-18(10-17(27)24(14)31-5)32-25-16(11-26)21(28)15(9-7-13(3)4)22(29)20(25)23(19)30/h6-7,10-11,27-29H,8-9H2,1-5H3
InChIKey: InChIKey=JEENJJQVTSVKRW-UHFFFAOYSA-N
Formula: C25H26O7
Molecular Weight: 438.470692
Exact Mass: 438.167853
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Panthong, K., Pongcharoen, W., Phongpaichit, S., Taylor, W.C. Phytochemistry (2006) 67, 999-1004
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 167.09 |
| 2 (C) | 111 |
| 3 (C) | 167 |
| 4 (C) | 102.07 |
| 4a (C) | 157.49 |
| 5 (CH) | 101.77 |
| 6 (C) | 154.89 |
| 7 (C) | 143.45 |
| 8 (C) | 137.48 |
| 8a (C) | 112.35 |
| 9 (C) | 181.32 |
| 9a (C) | 102.3 |
| 10a (C) | 155.2 |
| 1' (CH) | 190.08 |
| 1'' (CH2) | 26.6 |
| 2'' (CH) | 122.57 |
| 3'' (C) | 132.63 |
| 4'' (CH3) | 25.79 |
| 5'' (CH3) | 18.23 |
| 2a (CH2) | 20.51 |
| 2b (CH) | 121.08 |
| 2c (C) | 132.62 |
| 2d (CH3) | 17.81 |
| 2e (CH3) | 25.8 |
| 7a (CH3) | 62.15 |