Common Name: Laurentixanthone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C17H16O7/c1-20-13-11-12(19)10-8(18)6-5-7-9(10)24-14(11)16(22-3)17(23-4)15(13)21-2/h5-7,18H,1-4H3
InChIKey: InChIKey=UCQGYGZMFYUAGY-UHFFFAOYSA-N
Formula: C17H16O7
Molecular Weight: 332.305397
Exact Mass: 332.089603
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Nguemeving, J.R., Azebaze, A.G., Kuete, V., Eric Carly, N.N., Beng, V.P., Meyer, M., Blond, A., Bodo, B., Nkengfack, A.E. Phytochemistry (2006) 67, 1341-6
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 162 |
| 2 (CH) | 110.7 |
| 3 (CH) | 136.1 |
| 4 (CH) | 106.4 |
| 4a (C) | 155.3 |
| 5 (C) | 137.2 |
| 6 (C) | 147.7 |
| 7 (C) | 143.1 |
| 8 (C) | 149.4 |
| 8a (C) | 117 |
| 9 (C) | 181.6 |
| 9a (C) | 108.8 |
| 10a (C) | 153.2 |
| 1' (CH3) | 62.8 |
| 5a (CH3) | 61.6 |
| 6a (CH3) | 61.7 |
| 7a (CH3) | 62 |