Common Name: Polyanxanthone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H24O4/c1-15(2)11-13-25-18-8-6-9-19-21(18)22(24)17-7-5-10-20(23(17)27-19)26-14-12-16(3)4/h5-12H,13-14H2,1-4H3
InChIKey: InChIKey=HTOQJHACSVETFN-UHFFFAOYSA-N
Formula: C23H24O4
Molecular Weight: 364.435123
Exact Mass: 364.167459
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Louh, G.N., Lannang, A.M., Mbazoa, C.D., Tangmouo, J.G., Komguem, J., Castilho, P., Ngninzeko, F.N., Qamar, N., Lontsi, D., Choudhary, M.I., Sondengam, B.L. Phytochemistry (2008) 69, 1013-7
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 159.6 |
| 2 (CH) | 106.7 |
| 3 (CH) | 134.5 |
| 4 (CH) | 110.2 |
| 4a (C) | 157.9 |
| 5 (C) | 147.3 |
| 6 (CH) | 116.6 |
| 7 (CH) | 123.1 |
| 8 (CH) | 117.8 |
| 8a (C) | 124 |
| 9 (C) | 176.4 |
| 9a (C) | 112.7 |
| 10a (C) | 145.7 |
| 1a (CH2) | 66.4 |
| 1b (CH) | 119.3 |
| 1c (C) | 137.6 |
| 1d (CH3) | 18.3 |
| 1e (CH3) | 25.8 |
| 5a (CH2) | 66.4 |
| 5b (CH) | 119.4 |
| 5c (C) | 138.6 |
| 5d (CH3) | 25.9 |
| 5e (CH3) | 18.4 |