Common Name: Lindenanolide F
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C30H34O6/c1-11-15-7-17(15)27(5)9-29(21(23(31)19(11)27)13(3)25(33)35-29)30-10-28(6)18-8-16(18)12(2)20(28)24(32)22(30)14(4)26(34)36-30/h15-20,23-24,31-32H,1-2,7-10H2,3-6H3/t15-,16-,17-,18-,19-,20+,23-,24-,27+,28-,29-,30-/m1/s1
InChIKey: InChIKey=JGQHCPBYZRSGTI-SXTMCUQWSA-N
Formula: C30H34O6
Molecular Weight: 490.588492
Exact Mass: 490.235539
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Zhang, C.F., Nakamura, N., Tewtrakul, S., Hattori, M., Sun, Q.S., Wang, Z.T., Fujiwara, T. Chem Pharm Bull (2002) 50, 1195-200
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Cycloeudesmanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 29.4 |
| 2 (CH2) | 16.3 |
| 3 (CH) | 23.8 |
| 4 (C) | 149.6 |
| 5 (CH) | 64.4 |
| 6 (CH) | 63.9 |
| 7 (C) | 158 |
| 8 (C) | 92.3 |
| 9 (CH2) | 45.2 |
| 10 (C) | 38.8 |
| 11 (C) | 133.6 |
| 12 (C) | 172.7 |
| 13 (CH3) | 8.9 |
| 14 (CH3) | 19.9 |
| 15 (CH2) | 106.9 |
| 1' (CH) | 29.4 |
| 2' (CH2) | 16.3 |
| 3' (CH) | 23.8 |
| 4' (C) | 149.6 |
| 5' (CH) | 64.4 |
| 6' (CH) | 63.9 |
| 7' (C) | 158 |
| 8' (C) | 92.3 |
| 9' (CH2) | 45.2 |
| 10' (C) | 38.8 |
| 11' (C) | 133.6 |
| 12' (C) | 172.7 |
| 13' (CH3) | 8.9 |
| 14' (CH3) | 19.9 |
| 15' (CH2) | 106.9 |