Spektraris NMR
Anisocoumarin H
Common Name: Anisocoumarin H
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C19H22O4/c1-13(2)10-16(20)11-14(3)8-9-22-17-6-4-15-5-7-19(21)23-18(15)12-17/h4-8,10,12,16,20H,9,11H2,1-3H3/b14-8+
InChIKey: InChIKey=VNADFOGBKXRWGC-RIYZIHGNSA-N
Formula: C19H22O4
Molecular Weight: 314.376298
Exact Mass: 314.151809
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Ngadjui, B.T., Ayafor, J.F., Sondengam, B.L., Connoly, J.D. J Nat Prod (1989) 52, 243-7
Species:
Notes: Family : Terpenoids, Type : Meromonoterpenoids, Group : Dimethyloctanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
Carbon NMR Peaks
| Position | PPM |
|---|---|
| 1 (CH2) | 63.3 |
| 2 (CH) | 128.8 |
| 3 (C) | 138.9 |
| 4 (CH2) | 47.7 |
| 5 (CH) | 66.5 |
| 6 (CH) | 121.8 |
| 7 (C) | 135.5 |
| 8 (CH3) | 25.7 |
| 9 (CH3) | 18.2 |
| 10 (CH3) | 17.1 |
| 2' (C) | 162.1 |
| 3' (CH) | 113.1 |
| 4' (CH) | 143.5 |
| 5' (CH) | 127.4 |
| 6' (CH) | 113.2 |
| 7' (C) | 161.3 |
| 8' (CH) | 101.7 |
| 9' (C) | 155.9 |
| 10' (C) | 112.7 |
